C17H15NO4 — CID 54691271
4-hydroxy-7-methoxy-3-(2-methoxyphenyl)-1H-quinolin-2-one (PubChem CID 54691271) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-hydroxy-7-methoxy-3-(2-methoxyphenyl)-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-7-methoxy-3-(2-methoxyphenyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54691271 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-hydroxy-7-methoxy-3-(2-methoxyphenyl)-1H-quinolin-2-one |
| SMILES | COc1ccc2c(O)c(-c3ccccc3OC)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H15NO4/c1-21-10-7-8-11-13(9-10)18-17(20)15(16(11)19)12-5-3-4-6-14(12)22-2/h3-9H,1-2H3,(H2,18,19,20) |
| InChIKey | BSDPXONXXAOFAD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |