C15H7BrINO — CID 162354038
2-bromo-7-iodo-5H-indeno[1,2-b]indol-10-one (PubChem CID 162354038) has the molecular formula C15H7BrINO and a molecular weight of 424.04 g/mol. Its IUPAC name is 2-bromo-7-iodo-5H-indeno[1,2-b]indol-10-one.
| Compound Name | 2-bromo-7-iodo-5H-indeno[1,2-b]indol-10-one |
|---|---|
| PubChem CID | 162354038 |
| Molecular Formula | C15H7BrINO |
| Molecular Weight | 424.04 g/mol |
| Exact Mass | 422.88 |
| IUPAC Name | 2-bromo-7-iodo-5H-indeno[1,2-b]indol-10-one |
| SMILES | O=C1c2cc(Br)ccc2-c2[nH]c3cc(I)ccc3c21 |
| InChI | InChI=1S/C15H7BrINO/c16-7-1-3-9-11(5-7)15(19)13-10-4-2-8(17)6-12(10)18-14(9)13/h1-6,18H |
| InChIKey | WMLFWZZOWGGQMQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.04 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|