C14H6BrClO2 — CID 157462041
6-bromo-1-chloroanthracene-9,10-dione (PubChem CID 157462041) has the molecular formula C14H6BrClO2 and a molecular weight of 321.56 g/mol. Its IUPAC name is 6-bromo-1-chloroanthracene-9,10-dione.
| Compound Name | 6-bromo-1-chloroanthracene-9,10-dione |
|---|---|
| PubChem CID | 157462041 |
| Molecular Formula | C14H6BrClO2 |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 6-bromo-1-chloroanthracene-9,10-dione |
| SMILES | O=C1c2cc(Br)ccc2C(=O)c2c(Cl)cccc21 |
| InChI | InChI=1S/C14H6BrClO2/c15-7-4-5-8-10(6-7)13(17)9-2-1-3-11(16)12(9)14(8)18/h1-6H |
| InChIKey | BUAPNSIRPFXVJR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|