C13H5Cl3O — CID 82579530
3,4,5-trichlorofluoren-9-one (PubChem CID 82579530) has the molecular formula C13H5Cl3O and a molecular weight of 283.54 g/mol. Its IUPAC name is 3,4,5-trichlorofluoren-9-one.
| Compound Name | 3,4,5-trichlorofluoren-9-one |
|---|---|
| PubChem CID | 82579530 |
| Molecular Formula | C13H5Cl3O |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | 3,4,5-trichlorofluoren-9-one |
| SMILES | O=C1c2cccc(Cl)c2-c2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C13H5Cl3O/c14-8-3-1-2-6-10(8)11-7(13(6)17)4-5-9(15)12(11)16/h1-5H |
| InChIKey | QLTWSOADRREKNR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |