C47H33ClO6 — CID 174787165
anthracene-9,10-dione;1-chloroanthracene-9,10-dione;2-pentylanthracene-9,10-dione (PubChem CID 174787165) has the molecular formula C47H33ClO6 and a molecular weight of 729.23 g/mol. Its IUPAC name is anthracene-9,10-dione;1-chloroanthracene-9,10-dione;2-pentylanthracene-9,10-dione.
| Compound Name | anthracene-9,10-dione;1-chloroanthracene-9,10-dione;2-pentylanthracene-9,10-dione |
|---|---|
| PubChem CID | 174787165 |
| Molecular Formula | C47H33ClO6 |
| Molecular Weight | 729.23 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | anthracene-9,10-dione;1-chloroanthracene-9,10-dione;2-pentylanthracene-9,10-dione |
| SMILES | CCCCCc1ccc2c(c1)C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2c(Cl)cccc21.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H18O2.C14H7ClO2.C14H8O2/c1-2-3-4-7-13-10-11-16-17(12-13)19(21)15-9-6-5-8-14(15)18(16)20;15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h5-6,8-12H,2-4,7H2,1H3;1-7H;1-8H |
| InChIKey | YKPDPWVCEBVKSO-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.23 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|