C20H25ClO4 — CID 23038590
5-chloro-2,3-dipentoxynaphthalene-1,4-dione (PubChem CID 23038590) has the molecular formula C20H25ClO4 and a molecular weight of 364.87 g/mol. Its IUPAC name is 5-chloro-2,3-dipentoxynaphthalene-1,4-dione.
| Compound Name | 5-chloro-2,3-dipentoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 23038590 |
| Molecular Formula | C20H25ClO4 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-chloro-2,3-dipentoxynaphthalene-1,4-dione |
| SMILES | CCCCCOC1=C(OCCCCC)C(=O)c2c(Cl)cccc2C1=O |
| InChI | InChI=1S/C20H25ClO4/c1-3-5-7-12-24-19-17(22)14-10-9-11-15(21)16(14)18(23)20(19)25-13-8-6-4-2/h9-11H,3-8,12-13H2,1-2H3 |
| InChIKey | YCQXVXVCTWETDZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|