C15H15ClO3 — CID 10945787
2-chloro-3-pentoxynaphthalene-1,4-dione (PubChem CID 10945787) has the molecular formula C15H15ClO3 and a molecular weight of 278.73 g/mol. Its IUPAC name is 2-chloro-3-pentoxynaphthalene-1,4-dione.
| Compound Name | 2-chloro-3-pentoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10945787 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-chloro-3-pentoxynaphthalene-1,4-dione |
| SMILES | CCCCCOC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15ClO3/c1-2-3-6-9-19-15-12(16)13(17)10-7-4-5-8-11(10)14(15)18/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | FKTNEHBPOUNDCU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|