C28H26O6 — CID 139785691
2-[1-(1,4-dioxo-3-propoxynaphthalen-2-yl)ethyl]-3-propoxynaphthalene-1,4-dione (PubChem CID 139785691) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[1-(1,4-dioxo-3-propoxynaphthalen-2-yl)ethyl]-3-propoxynaphthalene-1,4-dione.
| Compound Name | 2-[1-(1,4-dioxo-3-propoxynaphthalen-2-yl)ethyl]-3-propoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 139785691 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[1-(1,4-dioxo-3-propoxynaphthalen-2-yl)ethyl]-3-propoxynaphthalene-1,4-dione |
| SMILES | CCCOC1=C(C(C)C2=C(OCCC)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H26O6/c1-4-14-33-27-21(23(29)17-10-6-8-12-19(17)25(27)31)16(3)22-24(30)18-11-7-9-13-20(18)26(32)28(22)34-15-5-2/h6-13,16H,4-5,14-15H2,1-3H3 |
| InChIKey | OWISXUBAWMYVBT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|