C17H17NO4 — CID 149158683
5,8-dioxo-6,7-dipropoxynaphthalene-2-carbonitrile (PubChem CID 149158683) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 5,8-dioxo-6,7-dipropoxynaphthalene-2-carbonitrile.
| Compound Name | 5,8-dioxo-6,7-dipropoxynaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 149158683 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5,8-dioxo-6,7-dipropoxynaphthalene-2-carbonitrile |
| SMILES | CCCOC1=C(OCCC)C(=O)c2cc(C#N)ccc2C1=O |
| InChI | InChI=1S/C17H17NO4/c1-3-7-21-16-14(19)12-6-5-11(10-18)9-13(12)15(20)17(16)22-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | VFXUZOHTEOMGCA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|