C17H14N2OS — CID 10565745
2-(4-propoxyphenyl)sulfanylbenzene-1,4-dicarbonitrile (PubChem CID 10565745) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(4-propoxyphenyl)sulfanylbenzene-1,4-dicarbonitrile.
| Compound Name | 2-(4-propoxyphenyl)sulfanylbenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 10565745 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-(4-propoxyphenyl)sulfanylbenzene-1,4-dicarbonitrile |
| SMILES | CCCOc1ccc(Sc2cc(C#N)ccc2C#N)cc1 |
| InChI | InChI=1S/C17H14N2OS/c1-2-9-20-15-5-7-16(8-6-15)21-17-10-13(11-18)3-4-14(17)12-19/h3-8,10H,2,9H2,1H3 |
| InChIKey | HNXBOLATMJKPGX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |