C16H14N2O — CID 23118700
3-butoxynaphthalene-2,7-dicarbonitrile (PubChem CID 23118700) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-butoxynaphthalene-2,7-dicarbonitrile.
| Compound Name | 3-butoxynaphthalene-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 23118700 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-butoxynaphthalene-2,7-dicarbonitrile |
| SMILES | CCCCOc1cc2ccc(C#N)cc2cc1C#N |
| InChI | InChI=1S/C16H14N2O/c1-2-3-6-19-16-9-13-5-4-12(10-17)7-14(13)8-15(16)11-18/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | RXBNHTPYFHMDAL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|