C17H17FN2O — CID 78916050
3-fluoro-4-[(4-propoxyphenyl)methylamino]benzonitrile (PubChem CID 78916050) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-fluoro-4-[(4-propoxyphenyl)methylamino]benzonitrile.
| Compound Name | 3-fluoro-4-[(4-propoxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 78916050 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-fluoro-4-[(4-propoxyphenyl)methylamino]benzonitrile |
| SMILES | CCCOc1ccc(CNc2ccc(C#N)cc2F)cc1 |
| InChI | InChI=1S/C17H17FN2O/c1-2-9-21-15-6-3-13(4-7-15)12-20-17-8-5-14(11-19)10-16(17)18/h3-8,10,20H,2,9,12H2,1H3 |
| InChIKey | DJCOXFATPKMOJE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |