C19H20N2O2 — CID 133456344
4-acetyl-3-[(4-propoxyphenyl)methylamino]benzonitrile (PubChem CID 133456344) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-acetyl-3-[(4-propoxyphenyl)methylamino]benzonitrile.
| Compound Name | 4-acetyl-3-[(4-propoxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133456344 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-acetyl-3-[(4-propoxyphenyl)methylamino]benzonitrile |
| SMILES | CCCOc1ccc(CNc2cc(C#N)ccc2C(C)=O)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-3-10-23-17-7-4-15(5-8-17)13-21-19-11-16(12-20)6-9-18(19)14(2)22/h4-9,11,21H,3,10,13H2,1-2H3 |
| InChIKey | SECZPDUXGRPQFN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |