C13H15N3O2 — CID 133466049
2-(2-acetyl-5-cyanoanilino)-N,N-dimethylacetamide (PubChem CID 133466049) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(2-acetyl-5-cyanoanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(2-acetyl-5-cyanoanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 133466049 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-(2-acetyl-5-cyanoanilino)-N,N-dimethylacetamide |
| SMILES | CC(=O)c1ccc(C#N)cc1NCC(=O)N(C)C |
| InChI | InChI=1S/C13H15N3O2/c1-9(17)11-5-4-10(7-14)6-12(11)15-8-13(18)16(2)3/h4-6,15H,8H2,1-3H3 |
| InChIKey | YPBKOEBAAHXEKI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |