C17H16N2O3S — CID 133456824
4-acetyl-3-[2-(benzenesulfonyl)ethylamino]benzonitrile (PubChem CID 133456824) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-acetyl-3-[2-(benzenesulfonyl)ethylamino]benzonitrile.
| Compound Name | 4-acetyl-3-[2-(benzenesulfonyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133456824 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-acetyl-3-[2-(benzenesulfonyl)ethylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-13(20)16-8-7-14(12-18)11-17(16)19-9-10-23(21,22)15-5-3-2-4-6-15/h2-8,11,19H,9-10H2,1H3 |
| InChIKey | GSYJAXUCAOEYCW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |