C17H14F2N2O — CID 133456455
4-acetyl-3-[2-(2,6-difluorophenyl)ethylamino]benzonitrile (PubChem CID 133456455) has the molecular formula C17H14F2N2O and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-acetyl-3-[2-(2,6-difluorophenyl)ethylamino]benzonitrile.
| Compound Name | 4-acetyl-3-[2-(2,6-difluorophenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133456455 |
| Molecular Formula | C17H14F2N2O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-acetyl-3-[2-(2,6-difluorophenyl)ethylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NCCc1c(F)cccc1F |
| InChI | InChI=1S/C17H14F2N2O/c1-11(22)13-6-5-12(10-20)9-17(13)21-8-7-14-15(18)3-2-4-16(14)19/h2-6,9,21H,7-8H2,1H3 |
| InChIKey | FDDBGMXRYSMLNK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |