C18H24N2O2 — CID 133456219
4-acetyl-3-[2-(2-methylcyclohexyl)oxyethylamino]benzonitrile (PubChem CID 133456219) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-acetyl-3-[2-(2-methylcyclohexyl)oxyethylamino]benzonitrile.
| Compound Name | 4-acetyl-3-[2-(2-methylcyclohexyl)oxyethylamino]benzonitrile |
|---|---|
| PubChem CID | 133456219 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-acetyl-3-[2-(2-methylcyclohexyl)oxyethylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NCCOC1CCCCC1C |
| InChI | InChI=1S/C18H24N2O2/c1-13-5-3-4-6-18(13)22-10-9-20-17-11-15(12-19)7-8-16(17)14(2)21/h7-8,11,13,18,20H,3-6,9-10H2,1-2H3 |
| InChIKey | WQFFMHSVQIJAKB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|