C17H14Cl2N2O2 — CID 133458309
4-acetyl-3-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]benzonitrile (PubChem CID 133458309) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 4-acetyl-3-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]benzonitrile.
| Compound Name | 4-acetyl-3-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 133458309 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-acetyl-3-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-10(22)15-3-2-11(8-20)4-16(15)21-9-17(23)12-5-13(18)7-14(19)6-12/h2-7,17,21,23H,9H2,1H3 |
| InChIKey | BSZCRGKZHNKJQZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |