C46H54O4S4 — CID 177307611
1,2,3,4-tetrakis[(4-butoxyphenyl)sulfanyl]benzene (PubChem CID 177307611) has the molecular formula C46H54O4S4 and a molecular weight of 799.20 g/mol. Its IUPAC name is 1,2,3,4-tetrakis[(4-butoxyphenyl)sulfanyl]benzene.
| Compound Name | 1,2,3,4-tetrakis[(4-butoxyphenyl)sulfanyl]benzene |
|---|---|
| PubChem CID | 177307611 |
| Molecular Formula | C46H54O4S4 |
| Molecular Weight | 799.20 g/mol |
| Exact Mass | 798.29 |
| IUPAC Name | 1,2,3,4-tetrakis[(4-butoxyphenyl)sulfanyl]benzene |
| SMILES | CCCCOc1ccc(Sc2ccc(Sc3ccc(OCCCC)cc3)c(Sc3ccc(OCCCC)cc3)c2Sc2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C46H54O4S4/c1-5-9-31-47-35-13-21-39(22-14-35)51-43-29-30-44(52-40-23-15-36(16-24-40)48-32-10-6-2)46(54-42-27-19-38(20-28-42)50-34-12-8-4)45(43)53-41-25-17-37(18-26-41)49-33-11-7-3/h13-30H,5-12,31-34H2,1-4H3 |
| InChIKey | YHCHVHILPMYZLX-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.20 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|