C20H26OS — CID 129045987
1,3,5-trimethyl-2-(4-pentoxyphenyl)sulfanylbenzene (PubChem CID 129045987) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(4-pentoxyphenyl)sulfanylbenzene.
| Compound Name | 1,3,5-trimethyl-2-(4-pentoxyphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 129045987 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1,3,5-trimethyl-2-(4-pentoxyphenyl)sulfanylbenzene |
| SMILES | CCCCCOc1ccc(Sc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H26OS/c1-5-6-7-12-21-18-8-10-19(11-9-18)22-20-16(3)13-15(2)14-17(20)4/h8-11,13-14H,5-7,12H2,1-4H3 |
| InChIKey | SXDIJFYRPNODDC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|