C20H26IO+ — CID 89019643
(4-pentoxyphenyl)-(2,4,6-trimethylphenyl)iodanium (PubChem CID 89019643) has the molecular formula C20H26IO+ and a molecular weight of 409.33 g/mol. Its IUPAC name is (4-pentoxyphenyl)-(2,4,6-trimethylphenyl)iodanium.
| Compound Name | (4-pentoxyphenyl)-(2,4,6-trimethylphenyl)iodanium |
|---|---|
| PubChem CID | 89019643 |
| Molecular Formula | C20H26IO+ |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (4-pentoxyphenyl)-(2,4,6-trimethylphenyl)iodanium |
| SMILES | CCCCCOc1ccc([I+]c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H26IO/c1-5-6-7-12-22-19-10-8-18(9-11-19)21-20-16(3)13-15(2)14-17(20)4/h8-11,13-14H,5-7,12H2,1-4H3/q+1 |
| InChIKey | ZZTZUSWYWDDNHP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|