C25H36IO2+ — CID 87172585
(4-decoxyphenyl)-(4-methoxy-2,6-dimethylphenyl)iodanium (PubChem CID 87172585) has the molecular formula C25H36IO2+ and a molecular weight of 495.47 g/mol. Its IUPAC name is (4-decoxyphenyl)-(4-methoxy-2,6-dimethylphenyl)iodanium.
| Compound Name | (4-decoxyphenyl)-(4-methoxy-2,6-dimethylphenyl)iodanium |
|---|---|
| PubChem CID | 87172585 |
| Molecular Formula | C25H36IO2+ |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (4-decoxyphenyl)-(4-methoxy-2,6-dimethylphenyl)iodanium |
| SMILES | CCCCCCCCCCOc1ccc([I+]c2c(C)cc(OC)cc2C)cc1 |
| InChI | InChI=1S/C25H36IO2/c1-5-6-7-8-9-10-11-12-17-28-23-15-13-22(14-16-23)26-25-20(2)18-24(27-4)19-21(25)3/h13-16,18-19H,5-12,17H2,1-4H3/q+1 |
| InChIKey | JAOHXQKSXVFDHN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|