C21H28F6IO4P — CID 162062630
(4-hexoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium hexafluorophosphate (PubChem CID 162062630) has the molecular formula C21H28F6IO4P and a molecular weight of 616.32 g/mol. Its IUPAC name is (4-hexoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium hexafluorophosphate.
| Compound Name | (4-hexoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium hexafluorophosphate |
|---|---|
| PubChem CID | 162062630 |
| Molecular Formula | C21H28F6IO4P |
| Molecular Weight | 616.32 g/mol |
| Exact Mass | 616.07 |
| IUPAC Name | (4-hexoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium hexafluorophosphate |
| SMILES | CCCCCCOc1ccc([I+]c2c(OC)cc(OC)cc2OC)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C21H28IO4.F6P/c1-5-6-7-8-13-26-17-11-9-16(10-12-17)22-21-19(24-3)14-18(23-2)15-20(21)25-4;1-7(2,3,4,5)6/h9-12,14-15H,5-8,13H2,1-4H3;/q+1;-1 |
| InChIKey | ZAAUJGNOVQNRPJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|