C23H32F6IO4P-2 — CID 162330163
1,3,5-trimethoxy-2-(4-octoxyphenyl)iodanuidylbenzene hexafluorophosphate (PubChem CID 162330163) has the molecular formula C23H32F6IO4P-2 and a molecular weight of 644.37 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2-(4-octoxyphenyl)iodanuidylbenzene hexafluorophosphate.
| Compound Name | 1,3,5-trimethoxy-2-(4-octoxyphenyl)iodanuidylbenzene hexafluorophosphate |
|---|---|
| PubChem CID | 162330163 |
| Molecular Formula | C23H32F6IO4P-2 |
| Molecular Weight | 644.37 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | 1,3,5-trimethoxy-2-(4-octoxyphenyl)iodanuidylbenzene hexafluorophosphate |
| SMILES | CCCCCCCCOc1ccc([I-]c2c(OC)cc(OC)cc2OC)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C23H32IO4.F6P/c1-5-6-7-8-9-10-15-28-19-13-11-18(12-14-19)24-23-21(26-3)16-20(25-2)17-22(23)27-4;1-7(2,3,4,5)6/h11-14,16-17H,5-10,15H2,1-4H3;/q2*-1 |
| InChIKey | PABXKDVHGMJFRZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|