C22H30BF4IO3 — CID 87144869
(2,4-diethoxyphenyl)-(4-hexoxyphenyl)iodanium tetrafluoroborate (PubChem CID 87144869) has the molecular formula C22H30BF4IO3 and a molecular weight of 556.19 g/mol. Its IUPAC name is (2,4-diethoxyphenyl)-(4-hexoxyphenyl)iodanium tetrafluoroborate.
| Compound Name | (2,4-diethoxyphenyl)-(4-hexoxyphenyl)iodanium tetrafluoroborate |
|---|---|
| PubChem CID | 87144869 |
| Molecular Formula | C22H30BF4IO3 |
| Molecular Weight | 556.19 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | (2,4-diethoxyphenyl)-(4-hexoxyphenyl)iodanium tetrafluoroborate |
| SMILES | CCCCCCOc1ccc([I+]c2ccc(OCC)cc2OCC)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H30IO3.BF4/c1-4-7-8-9-16-26-19-12-10-18(11-13-19)23-21-15-14-20(24-5-2)17-22(21)25-6-3;2-1(3,4)5/h10-15,17H,4-9,16H2,1-3H3;/q+1;-1 |
| InChIKey | BYOJNDXISPCALK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.19 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|