C16H26OS — CID 59154737
1-(4,4-dimethylpentoxy)-4-propylsulfanylbenzene (PubChem CID 59154737) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-(4,4-dimethylpentoxy)-4-propylsulfanylbenzene.
| Compound Name | 1-(4,4-dimethylpentoxy)-4-propylsulfanylbenzene |
|---|---|
| PubChem CID | 59154737 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-(4,4-dimethylpentoxy)-4-propylsulfanylbenzene |
| SMILES | CCCSc1ccc(OCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26OS/c1-5-13-18-15-9-7-14(8-10-15)17-12-6-11-16(2,3)4/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | DDJKOUWCTGMLCO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|