C15H25NOS — CID 122580335
N,N-dimethyl-2-(4-pentylsulfanylphenoxy)ethanamine (PubChem CID 122580335) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-pentylsulfanylphenoxy)ethanamine.
| Compound Name | N,N-dimethyl-2-(4-pentylsulfanylphenoxy)ethanamine |
|---|---|
| PubChem CID | 122580335 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N,N-dimethyl-2-(4-pentylsulfanylphenoxy)ethanamine |
| SMILES | CCCCCSc1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C15H25NOS/c1-4-5-6-13-18-15-9-7-14(8-10-15)17-12-11-16(2)3/h7-10H,4-6,11-13H2,1-3H3 |
| InChIKey | YNRCOHHXKGDZFL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|