C11H10O4 — CID 139672196
5-propoxy-2-benzofuran-1,3-dione (PubChem CID 139672196) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 5-propoxy-2-benzofuran-1,3-dione.
| Compound Name | 5-propoxy-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 139672196 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-propoxy-2-benzofuran-1,3-dione |
| SMILES | CCCOc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C11H10O4/c1-2-5-14-7-3-4-8-9(6-7)11(13)15-10(8)12/h3-4,6H,2,5H2,1H3 |
| InChIKey | AUZBSBNJXALKQG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|