C14H16O4 — CID 88840475
5-hexoxy-2-benzofuran-1,3-dione (PubChem CID 88840475) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-hexoxy-2-benzofuran-1,3-dione.
| Compound Name | 5-hexoxy-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88840475 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-hexoxy-2-benzofuran-1,3-dione |
| SMILES | CCCCCCOc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C14H16O4/c1-2-3-4-5-8-17-10-6-7-11-12(9-10)14(16)18-13(11)15/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | WKIXABJXIQWDIS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|