C26H26O12 — CID 101165198
5-[2-[2-[2-[2-[2-[(1,3-dioxo-2-benzofuran-5-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-benzofuran-1,3-dione (PubChem CID 101165198) has the molecular formula C26H26O12 and a molecular weight of 530.48 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[2-[(1,3-dioxo-2-benzofuran-5-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-[2-[2-[2-[2-[(1,3-dioxo-2-benzofuran-5-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 101165198 |
| Molecular Formula | C26H26O12 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 5-[2-[2-[2-[2-[2-[(1,3-dioxo-2-benzofuran-5-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(OCCOCCOCCOCCOCCOc3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C26H26O12/c27-23-19-3-1-17(15-21(19)25(29)37-23)35-13-11-33-9-7-31-5-6-32-8-10-34-12-14-36-18-2-4-20-22(16-18)26(30)38-24(20)28/h1-4,15-16H,5-14H2 |
| InChIKey | ISTGHXBYDWKCHJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|