C12H11F3O4 — CID 63097111
6-[2-(2,2,2-trifluoroethoxy)ethoxy]-1-benzofuran-3-one (PubChem CID 63097111) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 6-[2-(2,2,2-trifluoroethoxy)ethoxy]-1-benzofuran-3-one.
| Compound Name | 6-[2-(2,2,2-trifluoroethoxy)ethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 63097111 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 6-[2-(2,2,2-trifluoroethoxy)ethoxy]-1-benzofuran-3-one |
| SMILES | O=C1COc2cc(OCCOCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H11F3O4/c13-12(14,15)7-17-3-4-18-8-1-2-9-10(16)6-19-11(9)5-8/h1-2,5H,3-4,6-7H2 |
| InChIKey | SYORIZQKPWLPRS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|