C14H16O5 — CID 66474358
6-[2-(1,3-dioxan-2-yl)ethoxy]-1-benzofuran-3-one (PubChem CID 66474358) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 6-[2-(1,3-dioxan-2-yl)ethoxy]-1-benzofuran-3-one.
| Compound Name | 6-[2-(1,3-dioxan-2-yl)ethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 66474358 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 6-[2-(1,3-dioxan-2-yl)ethoxy]-1-benzofuran-3-one |
| SMILES | O=C1COc2cc(OCCC3OCCCO3)ccc21 |
| InChI | InChI=1S/C14H16O5/c15-12-9-19-13-8-10(2-3-11(12)13)16-7-4-14-17-5-1-6-18-14/h2-3,8,14H,1,4-7,9H2 |
| InChIKey | NFTCFLBNAHJEAR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |