C14H18O3 — CID 55025234
6-(3,3-dimethylbutoxy)-1-benzofuran-3-one (PubChem CID 55025234) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 6-(3,3-dimethylbutoxy)-1-benzofuran-3-one.
| Compound Name | 6-(3,3-dimethylbutoxy)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 55025234 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 6-(3,3-dimethylbutoxy)-1-benzofuran-3-one |
| SMILES | CC(C)(C)CCOc1ccc2c(c1)OCC2=O |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)6-7-16-10-4-5-11-12(15)9-17-13(11)8-10/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | HWXUQSHKAILHMR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |