C18H22O5 — CID 139890592
(5-hexoxy-1,3-dioxoinden-2-yl) propanoate (PubChem CID 139890592) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (5-hexoxy-1,3-dioxoinden-2-yl) propanoate.
| Compound Name | (5-hexoxy-1,3-dioxoinden-2-yl) propanoate |
|---|---|
| PubChem CID | 139890592 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (5-hexoxy-1,3-dioxoinden-2-yl) propanoate |
| SMILES | CCCCCCOc1ccc2c(c1)C(=O)C(OC(=O)CC)C2=O |
| InChI | InChI=1S/C18H22O5/c1-3-5-6-7-10-22-12-8-9-13-14(11-12)17(21)18(16(13)20)23-15(19)4-2/h8-9,11,18H,3-7,10H2,1-2H3 |
| InChIKey | GLGUOQFKUHNHBU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|