C17H20O5 — CID 139638020
(5-butoxy-1,3-dioxoinden-2-yl) butanoate (PubChem CID 139638020) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is (5-butoxy-1,3-dioxoinden-2-yl) butanoate.
| Compound Name | (5-butoxy-1,3-dioxoinden-2-yl) butanoate |
|---|---|
| PubChem CID | 139638020 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (5-butoxy-1,3-dioxoinden-2-yl) butanoate |
| SMILES | CCCCOc1ccc2c(c1)C(=O)C(OC(=O)CCC)C2=O |
| InChI | InChI=1S/C17H20O5/c1-3-5-9-21-11-7-8-12-13(10-11)16(20)17(15(12)19)22-14(18)6-4-2/h7-8,10,17H,3-6,9H2,1-2H3 |
| InChIKey | AIZFNMZBMMEAGA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|