C16H16O5 — CID 139638047
(1,3-dioxo-4-prop-2-enoxyinden-2-yl) butanoate (PubChem CID 139638047) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (1,3-dioxo-4-prop-2-enoxyinden-2-yl) butanoate.
| Compound Name | (1,3-dioxo-4-prop-2-enoxyinden-2-yl) butanoate |
|---|---|
| PubChem CID | 139638047 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (1,3-dioxo-4-prop-2-enoxyinden-2-yl) butanoate |
| SMILES | C=CCOc1cccc2c1C(=O)C(OC(=O)CCC)C2=O |
| InChI | InChI=1S/C16H16O5/c1-3-6-12(17)21-16-14(18)10-7-5-8-11(20-9-4-2)13(10)15(16)19/h4-5,7-8,16H,2-3,6,9H2,1H3 |
| InChIKey | CMQFXVRPSLUPKM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|