C21H20O6 — CID 139638140
[4-[(4-methoxyphenyl)methoxy]-1,3-dioxoinden-2-yl] 2-methylpropanoate (PubChem CID 139638140) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)methoxy]-1,3-dioxoinden-2-yl] 2-methylpropanoate.
| Compound Name | [4-[(4-methoxyphenyl)methoxy]-1,3-dioxoinden-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 139638140 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [4-[(4-methoxyphenyl)methoxy]-1,3-dioxoinden-2-yl] 2-methylpropanoate |
| SMILES | COc1ccc(COc2cccc3c2C(=O)C(OC(=O)C(C)C)C3=O)cc1 |
| InChI | InChI=1S/C21H20O6/c1-12(2)21(24)27-20-18(22)15-5-4-6-16(17(15)19(20)23)26-11-13-7-9-14(25-3)10-8-13/h4-10,12,20H,11H2,1-3H3 |
| InChIKey | DLFSDCQYZDMZPP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|