C21H24O3 — CID 71146282
1-[2-(2-cyclopropylethyl)-6-[(4-methoxyphenyl)methoxy]phenyl]ethanone (PubChem CID 71146282) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[2-(2-cyclopropylethyl)-6-[(4-methoxyphenyl)methoxy]phenyl]ethanone.
| Compound Name | 1-[2-(2-cyclopropylethyl)-6-[(4-methoxyphenyl)methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 71146282 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[2-(2-cyclopropylethyl)-6-[(4-methoxyphenyl)methoxy]phenyl]ethanone |
| SMILES | COc1ccc(COc2cccc(CCC3CC3)c2C(C)=O)cc1 |
| InChI | InChI=1S/C21H24O3/c1-15(22)21-18(11-8-16-6-7-16)4-3-5-20(21)24-14-17-9-12-19(23-2)13-10-17/h3-5,9-10,12-13,16H,6-8,11,14H2,1-2H3 |
| InChIKey | CJOBXPXCRGMZCN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |