C17H18O5 — CID 170171124
2-(1,3-dioxolan-2-yl)-3-[(4-methoxyphenyl)methoxy]phenol (PubChem CID 170171124) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-3-[(4-methoxyphenyl)methoxy]phenol.
| Compound Name | 2-(1,3-dioxolan-2-yl)-3-[(4-methoxyphenyl)methoxy]phenol |
|---|---|
| PubChem CID | 170171124 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-3-[(4-methoxyphenyl)methoxy]phenol |
| SMILES | COc1ccc(COc2cccc(O)c2C2OCCO2)cc1 |
| InChI | InChI=1S/C17H18O5/c1-19-13-7-5-12(6-8-13)11-22-15-4-2-3-14(18)16(15)17-20-9-10-21-17/h2-8,17-18H,9-11H2,1H3 |
| InChIKey | VWNLCXGEUAGUDP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |