C18H16O5 — CID 175937035
4-[(4-methoxyphenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid (PubChem CID 175937035) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid.
| Compound Name | 4-[(4-methoxyphenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 175937035 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-[(4-methoxyphenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid |
| SMILES | COc1ccc(COc2cccc3oc(C)c(C(=O)O)c23)cc1 |
| InChI | InChI=1S/C18H16O5/c1-11-16(18(19)20)17-14(4-3-5-15(17)23-11)22-10-12-6-8-13(21-2)9-7-12/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | GQEWSJNJGABQOQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |