C19H20O4S — CID 141265886
1-[2-methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3-methylsulfanylprop-2-en-1-one (PubChem CID 141265886) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[2-methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3-methylsulfanylprop-2-en-1-one.
| Compound Name | 1-[2-methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3-methylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 141265886 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[2-methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3-methylsulfanylprop-2-en-1-one |
| SMILES | COc1ccc(COc2cccc(OC)c2C(=O)C=CSC)cc1 |
| InChI | InChI=1S/C19H20O4S/c1-21-15-9-7-14(8-10-15)13-23-18-6-4-5-17(22-2)19(18)16(20)11-12-24-3/h4-12H,13H2,1-3H3 |
| InChIKey | LWUVSOUZORFNSM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|