C15H16O4 — CID 139642993
(4-ethyl-1,3-dioxoinden-2-yl) 2-methylpropanoate (PubChem CID 139642993) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4-ethyl-1,3-dioxoinden-2-yl) 2-methylpropanoate.
| Compound Name | (4-ethyl-1,3-dioxoinden-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 139642993 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (4-ethyl-1,3-dioxoinden-2-yl) 2-methylpropanoate |
| SMILES | CCc1cccc2c1C(=O)C(OC(=O)C(C)C)C2=O |
| InChI | InChI=1S/C15H16O4/c1-4-9-6-5-7-10-11(9)13(17)14(12(10)16)19-15(18)8(2)3/h5-8,14H,4H2,1-3H3 |
| InChIKey | FMMIWJKHRQXPPF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|