C15H14O6 — CID 139638217
(4-acetyloxy-1,3-dioxoinden-2-yl) 2-methylpropanoate (PubChem CID 139638217) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is (4-acetyloxy-1,3-dioxoinden-2-yl) 2-methylpropanoate.
| Compound Name | (4-acetyloxy-1,3-dioxoinden-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 139638217 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (4-acetyloxy-1,3-dioxoinden-2-yl) 2-methylpropanoate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)C(OC(=O)C(C)C)C2=O |
| InChI | InChI=1S/C15H14O6/c1-7(2)15(19)21-14-12(17)9-5-4-6-10(20-8(3)16)11(9)13(14)18/h4-7,14H,1-3H3 |
| InChIKey | PBBRWDDRBYXZOF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|