C20H26O5 — CID 141160913
(4-octyl-1,3-dioxoinden-2-yl)methyl 2-hydroxyacetate (PubChem CID 141160913) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (4-octyl-1,3-dioxoinden-2-yl)methyl 2-hydroxyacetate.
| Compound Name | (4-octyl-1,3-dioxoinden-2-yl)methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 141160913 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4-octyl-1,3-dioxoinden-2-yl)methyl 2-hydroxyacetate |
| SMILES | CCCCCCCCc1cccc2c1C(=O)C(COC(=O)CO)C2=O |
| InChI | InChI=1S/C20H26O5/c1-2-3-4-5-6-7-9-14-10-8-11-15-18(14)20(24)16(19(15)23)13-25-17(22)12-21/h8,10-11,16,21H,2-7,9,12-13H2,1H3 |
| InChIKey | FQOVUOSKISUZQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|