C21H28O4 — CID 139642918
(4-octyl-1,3-dioxoinden-2-yl) butanoate (PubChem CID 139642918) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (4-octyl-1,3-dioxoinden-2-yl) butanoate.
| Compound Name | (4-octyl-1,3-dioxoinden-2-yl) butanoate |
|---|---|
| PubChem CID | 139642918 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (4-octyl-1,3-dioxoinden-2-yl) butanoate |
| SMILES | CCCCCCCCc1cccc2c1C(=O)C(OC(=O)CCC)C2=O |
| InChI | InChI=1S/C21H28O4/c1-3-5-6-7-8-9-12-15-13-10-14-16-18(15)20(24)21(19(16)23)25-17(22)11-4-2/h10,13-14,21H,3-9,11-12H2,1-2H3 |
| InChIKey | JBVDOHKCNHKPBZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|