About 2-butyl-6-octylaniline
2-butyl-6-octylaniline (PubChem CID 154074002) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-butyl-6-octylaniline.
Molecular Properties
| Compound Name | 2-butyl-6-octylaniline |
| PubChem CID | 154074002 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-butyl-6-octylaniline |
| SMILES | CCCCCCCCc1cccc(CCCC)c1N |
| InChI | InChI=1S/C18H31N/c1-3-5-7-8-9-10-13-17-15-11-14-16(18(17)19)12-6-4-2/h11,14-15H,3-10,12-13,19H2,1-2H3 |
| InChIKey | VZRKJOSPDVRHRZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-6-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-octylaniline?
The IUPAC name of 2-butyl-6-octylaniline (CID 154074002) is 2-butyl-6-octylaniline.
What is the SMILES notation for 2-butyl-6-octylaniline?
The canonical SMILES for 2-butyl-6-octylaniline is CCCCCCCCc1cccc(CCCC)c1N.
What is the InChIKey of 2-butyl-6-octylaniline?
The InChIKey is VZRKJOSPDVRHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N/c1-3-5-7-8-9-10-13-17-15-11-14-16(18(17)19)12-6-4-2/h11,14-15H,3-10,12-13,19H2,1-2H3.
What are the key properties of 2-butyl-6-octylaniline?
2-butyl-6-octylaniline has a molecular weight of 261.45 g/mol, XLogP of 5.51, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-octylaniline is sourced from PubChem (CID 154074002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).