About 3-hexadecylbenzene-1,2-diamine
3-hexadecylbenzene-1,2-diamine (PubChem CID 21486063) has the molecular formula C22H40N2
and a molecular weight of 332.58 g/mol. Its IUPAC name is 3-hexadecylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-hexadecylbenzene-1,2-diamine |
| PubChem CID | 21486063 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 3-hexadecylbenzene-1,2-diamine |
| SMILES | CCCCCCCCCCCCCCCCc1cccc(N)c1N |
| InChI | InChI=1S/C22H40N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-18-16-19-21(23)22(20)24/h16,18-19H,2-15,17,23-24H2,1H3 |
| InChIKey | HXRNLZIAERRCSF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-hexadecylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexadecylbenzene-1,2-diamine?
The IUPAC name of 3-hexadecylbenzene-1,2-diamine (CID 21486063) is 3-hexadecylbenzene-1,2-diamine.
What is the SMILES notation for 3-hexadecylbenzene-1,2-diamine?
The canonical SMILES for 3-hexadecylbenzene-1,2-diamine is CCCCCCCCCCCCCCCCc1cccc(N)c1N.
What is the InChIKey of 3-hexadecylbenzene-1,2-diamine?
The InChIKey is HXRNLZIAERRCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-18-16-19-21(23)22(20)24/h16,18-19H,2-15,17,23-24H2,1H3.
What are the key properties of 3-hexadecylbenzene-1,2-diamine?
3-hexadecylbenzene-1,2-diamine has a molecular weight of 332.58 g/mol, XLogP of 6.87, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexadecylbenzene-1,2-diamine is sourced from PubChem (CID 21486063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).