C12H7NO2 — CID 145350850
2-ethylidene-1,3-dioxoindene-5-carbonitrile (PubChem CID 145350850) has the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-ethylidene-1,3-dioxoindene-5-carbonitrile.
| Compound Name | 2-ethylidene-1,3-dioxoindene-5-carbonitrile |
|---|---|
| PubChem CID | 145350850 |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 2-ethylidene-1,3-dioxoindene-5-carbonitrile |
| SMILES | CC=C1C(=O)c2ccc(C#N)cc2C1=O |
| InChI | InChI=1S/C12H7NO2/c1-2-8-11(14)9-4-3-7(6-13)5-10(9)12(8)15/h2-5H,1H3 |
| InChIKey | QVYRHZAKQQYXQG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|