C34H17N3O2 — CID 138552114
8-(4-cyanophenyl)-12-[(1,3-dioxoinden-2-ylidene)methyl]-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene-4-carbonitrile (PubChem CID 138552114) has the molecular formula C34H17N3O2 and a molecular weight of 499.53 g/mol. Its IUPAC name is 8-(4-cyanophenyl)-12-[(1,3-dioxoinden-2-ylidene)methyl]-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene-4-carbonitrile.
| Compound Name | 8-(4-cyanophenyl)-12-[(1,3-dioxoinden-2-ylidene)methyl]-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene-4-carbonitrile |
|---|---|
| PubChem CID | 138552114 |
| Molecular Formula | C34H17N3O2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 8-(4-cyanophenyl)-12-[(1,3-dioxoinden-2-ylidene)methyl]-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene-4-carbonitrile |
| SMILES | N#Cc1ccc(N2c3ccc(C#N)cc3-c3cccc4c(C=C5C(=O)c6ccccc6C5=O)ccc2c34)cc1 |
| InChI | InChI=1S/C34H17N3O2/c35-18-20-8-12-23(13-9-20)37-30-14-10-21(19-36)16-28(30)25-7-3-6-24-22(11-15-31(37)32(24)25)17-29-33(38)26-4-1-2-5-27(26)34(29)39/h1-17H |
| InChIKey | PQFQUYJGHHWXAM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|