C33H20N2O2S — CID 138637061
4-(N-[4-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]phenyl]anilino)benzonitrile (PubChem CID 138637061) has the molecular formula C33H20N2O2S and a molecular weight of 508.60 g/mol. Its IUPAC name is 4-(N-[4-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]phenyl]anilino)benzonitrile.
| Compound Name | 4-(N-[4-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]phenyl]anilino)benzonitrile |
|---|---|
| PubChem CID | 138637061 |
| Molecular Formula | C33H20N2O2S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-(N-[4-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]phenyl]anilino)benzonitrile |
| SMILES | N#Cc1ccc(N(c2ccccc2)c2ccc(-c3ccc(C=C4C(=O)c5ccccc5C4=O)s3)cc2)cc1 |
| InChI | InChI=1S/C33H20N2O2S/c34-21-22-10-14-25(15-11-22)35(24-6-2-1-3-7-24)26-16-12-23(13-17-26)31-19-18-27(38-31)20-30-32(36)28-8-4-5-9-29(28)33(30)37/h1-20H |
| InChIKey | CYJWPRGBGTUTFZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|